C17H14ClFN2O3 — CID 46198988
N'-(4-chloro-3-fluorophenyl)-N-[(1R,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]oxamide (PubChem CID 46198988) has the molecular formula C17H14ClFN2O3 and a molecular weight of 348.76 g/mol. Its IUPAC name is N'-(4-chloro-3-fluorophenyl)-N-[(1R,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]oxamide.
| Compound Name | N'-(4-chloro-3-fluorophenyl)-N-[(1R,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]oxamide |
|---|---|
| PubChem CID | 46198988 |
| Molecular Formula | C17H14ClFN2O3 |
| Molecular Weight | 348.76 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | N'-(4-chloro-3-fluorophenyl)-N-[(1R,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]oxamide |
| SMILES | O=C(Nc1ccc(Cl)c(F)c1)C(=O)N[C@@H]1c2ccccc2C[C@H]1O |
| InChI | InChI=1S/C17H14ClFN2O3/c18-12-6-5-10(8-13(12)19)20-16(23)17(24)21-15-11-4-2-1-3-9(11)7-14(15)22/h1-6,8,14-15,22H,7H2,(H,20,23)(H,21,24)/t14-,15-/m1/s1 |
| InChIKey | FGOUDIWDTPGUNI-HUUCEWRRSA-N |
| XLogP | 2.19 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.76 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|