About N-(4-chloro-3-fluorophenyl)-N'-[1-(2-ethyl-1,2,4-triazol-3-yl)ethyl]oxamide
N-(4-chloro-3-fluorophenyl)-N'-[1-(2-ethyl-1,2,4-triazol-3-yl)ethyl]oxamide (PubChem CID 46198991) has the molecular formula C14H15ClFN5O2
and a molecular weight of 339.76 g/mol. Its IUPAC name is N-(4-chloro-3-fluorophenyl)-N'-[1-(2-ethyl-1,2,4-triazol-3-yl)ethyl]oxamide.
Molecular Properties
| Compound Name | N-(4-chloro-3-fluorophenyl)-N'-[1-(2-ethyl-1,2,4-triazol-3-yl)ethyl]oxamide |
| PubChem CID | 46198991 |
| Molecular Formula | C14H15ClFN5O2 |
| Molecular Weight | 339.76 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | N-(4-chloro-3-fluorophenyl)-N'-[1-(2-ethyl-1,2,4-triazol-3-yl)ethyl]oxamide |
| SMILES | CCn1ncnc1C(C)NC(=O)C(=O)Nc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C14H15ClFN5O2/c1-3-21-12(17-7-18-21)8(2)19-13(22)14(23)20-9-4-5-10(15)11(16)6-9/h4-8H,3H2,1-2H3,(H,19,22)(H,20,23) |
| InChIKey | OQFWKYRHADSFJO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.76 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(4-chloro-3-fluorophenyl)-N'-[1-(2-ethyl-1,2,4-triazol-3-yl)ethyl]oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-chloro-3-fluorophenyl)-N'-[1-(2-ethyl-1,2,4-triazol-3-yl)ethyl]oxamide?
The IUPAC name of N-(4-chloro-3-fluorophenyl)-N'-[1-(2-ethyl-1,2,4-triazol-3-yl)ethyl]oxamide (CID 46198991) is N-(4-chloro-3-fluorophenyl)-N'-[1-(2-ethyl-1,2,4-triazol-3-yl)ethyl]oxamide.
What is the SMILES notation for N-(4-chloro-3-fluorophenyl)-N'-[1-(2-ethyl-1,2,4-triazol-3-yl)ethyl]oxamide?
The canonical SMILES for N-(4-chloro-3-fluorophenyl)-N'-[1-(2-ethyl-1,2,4-triazol-3-yl)ethyl]oxamide is CCn1ncnc1C(C)NC(=O)C(=O)Nc1ccc(Cl)c(F)c1.
What is the InChIKey of N-(4-chloro-3-fluorophenyl)-N'-[1-(2-ethyl-1,2,4-triazol-3-yl)ethyl]oxamide?
The InChIKey is OQFWKYRHADSFJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15ClFN5O2/c1-3-21-12(17-7-18-21)8(2)19-13(22)14(23)20-9-4-5-10(15)11(16)6-9/h4-8H,3H2,1-2H3,(H,19,22)(H,20,23).
What are the key properties of N-(4-chloro-3-fluorophenyl)-N'-[1-(2-ethyl-1,2,4-triazol-3-yl)ethyl]oxamide?
N-(4-chloro-3-fluorophenyl)-N'-[1-(2-ethyl-1,2,4-triazol-3-yl)ethyl]oxamide has a molecular weight of 339.76 g/mol, XLogP of 1.91, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-chloro-3-fluorophenyl)-N'-[1-(2-ethyl-1,2,4-triazol-3-yl)ethyl]oxamide is sourced from PubChem (CID 46198991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).