C27H30N6O4 — CID 46199154
(5R)-5-[2-[6-[(4-ethylpiperazin-1-yl)methyl]-3-pyridinyl]ethynyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione (PubChem CID 46199154) has the molecular formula C27H30N6O4 and a molecular weight of 502.58 g/mol. Its IUPAC name is (5R)-5-[2-[6-[(4-ethylpiperazin-1-yl)methyl]-3-pyridinyl]ethynyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[2-[6-[(4-ethylpiperazin-1-yl)methyl]-3-pyridinyl]ethynyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 46199154 |
| Molecular Formula | C27H30N6O4 |
| Molecular Weight | 502.58 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | (5R)-5-[2-[6-[(4-ethylpiperazin-1-yl)methyl]-3-pyridinyl]ethynyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
| SMILES | CCN1CCN(Cc2ccc(C#C[C@]3(CN4Cc5ccc(OC)cc5C4=O)NC(=O)NC3=O)cn2)CC1 |
| InChI | InChI=1S/C27H30N6O4/c1-3-31-10-12-32(13-11-31)17-21-6-4-19(15-28-21)8-9-27(25(35)29-26(36)30-27)18-33-16-20-5-7-22(37-2)14-23(20)24(33)34/h4-7,14-15H,3,10-13,16-18H2,1-2H3,(H2,29,30,35,36)/t27-/m1/s1 |
| InChIKey | BHYQQGWCRAFAQI-HHHXNRCGSA-N |
| XLogP | 0.81 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.58 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|