C38H31NO7 — CID 46199226
(5S,5aS,8aR,9R)-5-(pyren-1-ylamino)-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one (PubChem CID 46199226) has the molecular formula C38H31NO7 and a molecular weight of 613.67 g/mol. Its IUPAC name is (5S,5aS,8aR,9R)-5-(pyren-1-ylamino)-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one.
| Compound Name | (5S,5aS,8aR,9R)-5-(pyren-1-ylamino)-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one |
|---|---|
| PubChem CID | 46199226 |
| Molecular Formula | C38H31NO7 |
| Molecular Weight | 613.67 g/mol |
| Exact Mass | 613.21 |
| IUPAC Name | (5S,5aS,8aR,9R)-5-(pyren-1-ylamino)-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one |
| SMILES | COc1cc([C@@H]2c3cc4c(cc3[C@@H](Nc3ccc5ccc6cccc7ccc3c5c67)[C@H]3COC(=O)[C@H]23)OCO4)cc(OC)c1OC |
| InChI | InChI=1S/C38H31NO7/c1-41-30-13-22(14-31(42-2)37(30)43-3)34-24-15-28-29(46-18-45-28)16-25(24)36(26-17-44-38(40)35(26)34)39-27-12-10-21-8-7-19-5-4-6-20-9-11-23(27)33(21)32(19)20/h4-16,26,34-36,39H,17-18H2,1-3H3/t26-,34+,35-,36+/m0/s1 |
| InChIKey | NTMAKYGMVPHOLS-ZDGZTXTGSA-N |
| XLogP | 7.43 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.67 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|