C21H20N4O7 — CID 46199252
[4-(4-nitrobenzoyl)-1-oxa-4,8-diazaspiro[4.5]decan-8-yl]-(4-nitrophenyl)methanone (PubChem CID 46199252) has the molecular formula C21H20N4O7 and a molecular weight of 440.41 g/mol. Its IUPAC name is [4-(4-nitrobenzoyl)-1-oxa-4,8-diazaspiro[4.5]decan-8-yl]-(4-nitrophenyl)methanone.
| Compound Name | [4-(4-nitrobenzoyl)-1-oxa-4,8-diazaspiro[4.5]decan-8-yl]-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 46199252 |
| Molecular Formula | C21H20N4O7 |
| Molecular Weight | 440.41 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | [4-(4-nitrobenzoyl)-1-oxa-4,8-diazaspiro[4.5]decan-8-yl]-(4-nitrophenyl)methanone |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)N1CCC2(CC1)OCCN2C(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H20N4O7/c26-19(15-1-5-17(6-2-15)24(28)29)22-11-9-21(10-12-22)23(13-14-32-21)20(27)16-3-7-18(8-4-16)25(30)31/h1-8H,9-14H2 |
| InChIKey | YOBSXLIIVAZYKE-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 136.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|