C22H20ClN5O3 — CID 46199341
3-[6-[[(5-chloro-6-methyl-1H-benzimidazol-2-yl)amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 46199341) has the molecular formula C22H20ClN5O3 and a molecular weight of 437.89 g/mol. Its IUPAC name is 3-[6-[[(5-chloro-6-methyl-1H-benzimidazol-2-yl)amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[(5-chloro-6-methyl-1H-benzimidazol-2-yl)amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 46199341 |
| Molecular Formula | C22H20ClN5O3 |
| Molecular Weight | 437.89 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 3-[6-[[(5-chloro-6-methyl-1H-benzimidazol-2-yl)amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | Cc1cc2[nH]c(NCc3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)nc2cc1Cl |
| InChI | InChI=1S/C22H20ClN5O3/c1-11-6-16-17(8-15(11)23)26-22(25-16)24-9-12-2-3-14-13(7-12)10-28(21(14)31)18-4-5-19(29)27-20(18)30/h2-3,6-8,18H,4-5,9-10H2,1H3,(H2,24,25,26)(H,27,29,30) |
| InChIKey | KZELLDASKZJMTO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.89 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|