C34H29NO7 — CID 46199382
(5S,5aS,8aR,9R)-5-(9H-fluoren-1-ylamino)-9-(4-hydroxy-3,5-dimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one (PubChem CID 46199382) has the molecular formula C34H29NO7 and a molecular weight of 563.61 g/mol. Its IUPAC name is (5S,5aS,8aR,9R)-5-(9H-fluoren-1-ylamino)-9-(4-hydroxy-3,5-dimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one.
| Compound Name | (5S,5aS,8aR,9R)-5-(9H-fluoren-1-ylamino)-9-(4-hydroxy-3,5-dimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one |
|---|---|
| PubChem CID | 46199382 |
| Molecular Formula | C34H29NO7 |
| Molecular Weight | 563.61 g/mol |
| Exact Mass | 563.19 |
| IUPAC Name | (5S,5aS,8aR,9R)-5-(9H-fluoren-1-ylamino)-9-(4-hydroxy-3,5-dimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one |
| SMILES | COc1cc([C@@H]2c3cc4c(cc3[C@@H](Nc3cccc5c3Cc3ccccc3-5)[C@H]3COC(=O)[C@H]23)OCO4)cc(OC)c1O |
| InChI | InChI=1S/C34H29NO7/c1-38-28-11-18(12-29(39-2)33(28)36)30-22-13-26-27(42-16-41-26)14-23(22)32(24-15-40-34(37)31(24)30)35-25-9-5-8-20-19-7-4-3-6-17(19)10-21(20)25/h3-9,11-14,24,30-32,35-36H,10,15-16H2,1-2H3/t24-,30+,31-,32+/m0/s1 |
| InChIKey | CNERPDZJSLNUPP-YZCUKXFTSA-N |
| XLogP | 5.80 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.61 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |