C39H31NO7 — CID 46199384
(5S,5aS,8aR,9R)-5-(chrysen-6-ylamino)-9-(4-hydroxy-3,5-dimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one (PubChem CID 46199384) has the molecular formula C39H31NO7 and a molecular weight of 625.68 g/mol. Its IUPAC name is (5S,5aS,8aR,9R)-5-(chrysen-6-ylamino)-9-(4-hydroxy-3,5-dimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one.
| Compound Name | (5S,5aS,8aR,9R)-5-(chrysen-6-ylamino)-9-(4-hydroxy-3,5-dimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one |
|---|---|
| PubChem CID | 46199384 |
| Molecular Formula | C39H31NO7 |
| Molecular Weight | 625.68 g/mol |
| Exact Mass | 625.21 |
| IUPAC Name | (5S,5aS,8aR,9R)-5-(chrysen-6-ylamino)-9-(4-hydroxy-3,5-dimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one |
| SMILES | COc1cc([C@@H]2c3cc4c(cc3[C@@H](Nc3cc5c6ccccc6ccc5c5ccccc35)[C@H]3COC(=O)[C@H]23)OCO4)cc(OC)c1O |
| InChI | InChI=1S/C39H31NO7/c1-43-33-13-21(14-34(44-2)38(33)41)35-27-16-31-32(47-19-46-31)17-28(27)37(29-18-45-39(42)36(29)35)40-30-15-26-22-8-4-3-7-20(22)11-12-24(26)23-9-5-6-10-25(23)30/h3-17,29,35-37,40-41H,18-19H2,1-2H3/t29-,35+,36-,37+/m0/s1 |
| InChIKey | NBMBSFZTFGJMGR-GTPNLVIDSA-N |
| XLogP | 7.69 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.68 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|