C28H22F3N5O4 — CID 46199806
3-[3-oxo-6-[[[5-phenoxy-6-(trifluoromethyl)-1H-benzimidazol-2-yl]amino]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 46199806) has the molecular formula C28H22F3N5O4 and a molecular weight of 549.51 g/mol. Its IUPAC name is 3-[3-oxo-6-[[[5-phenoxy-6-(trifluoromethyl)-1H-benzimidazol-2-yl]amino]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-6-[[[5-phenoxy-6-(trifluoromethyl)-1H-benzimidazol-2-yl]amino]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 46199806 |
| Molecular Formula | C28H22F3N5O4 |
| Molecular Weight | 549.51 g/mol |
| Exact Mass | 549.16 |
| IUPAC Name | 3-[3-oxo-6-[[[5-phenoxy-6-(trifluoromethyl)-1H-benzimidazol-2-yl]amino]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(CNc4nc5cc(Oc6ccccc6)c(C(F)(F)F)cc5[nH]4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C28H22F3N5O4/c29-28(30,31)19-11-20-21(12-23(19)40-17-4-2-1-3-5-17)34-27(33-20)32-13-15-6-7-18-16(10-15)14-36(26(18)39)22-8-9-24(37)35-25(22)38/h1-7,10-12,22H,8-9,13-14H2,(H2,32,33,34)(H,35,37,38) |
| InChIKey | SNDDGLKKTXLCRE-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 116.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.51 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|