C25H24F2N4O3 — CID 46200043
[(8E)-3-(2,5-difluorophenyl)-8-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-6,7-dihydro-5H-[1,2,4]oxadiazolo[4,3-a]pyridin-3-yl]methanol (PubChem CID 46200043) has the molecular formula C25H24F2N4O3 and a molecular weight of 466.49 g/mol. Its IUPAC name is [(8E)-3-(2,5-difluorophenyl)-8-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-6,7-dihydro-5H-[1,2,4]oxadiazolo[4,3-a]pyridin-3-yl]methanol.
| Compound Name | [(8E)-3-(2,5-difluorophenyl)-8-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-6,7-dihydro-5H-[1,2,4]oxadiazolo[4,3-a]pyridin-3-yl]methanol |
|---|---|
| PubChem CID | 46200043 |
| Molecular Formula | C25H24F2N4O3 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | [(8E)-3-(2,5-difluorophenyl)-8-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-6,7-dihydro-5H-[1,2,4]oxadiazolo[4,3-a]pyridin-3-yl]methanol |
| SMILES | COc1cc(/C=C2\CCCN3C2=NOC3(CO)c2cc(F)ccc2F)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C25H24F2N4O3/c1-16-13-30(15-28-16)22-8-5-17(11-23(22)33-2)10-18-4-3-9-31-24(18)29-34-25(31,14-32)20-12-19(26)6-7-21(20)27/h5-8,10-13,15,32H,3-4,9,14H2,1-2H3/b18-10+ |
| InChIKey | WTTOFUCZPBHEMB-VCHYOVAHSA-N |
| XLogP | 4.14 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |