C23H19F3N4O4 — CID 46200246
(5R)-5-[2-[4-(1-amino-2,2,2-trifluoroethyl)phenyl]ethynyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione (PubChem CID 46200246) has the molecular formula C23H19F3N4O4 and a molecular weight of 472.42 g/mol. Its IUPAC name is (5R)-5-[2-[4-(1-amino-2,2,2-trifluoroethyl)phenyl]ethynyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[2-[4-(1-amino-2,2,2-trifluoroethyl)phenyl]ethynyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 46200246 |
| Molecular Formula | C23H19F3N4O4 |
| Molecular Weight | 472.42 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | (5R)-5-[2-[4-(1-amino-2,2,2-trifluoroethyl)phenyl]ethynyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc2c(c1)C(=O)N(C[C@@]1(C#Cc3ccc(C(N)C(F)(F)F)cc3)NC(=O)NC1=O)C2 |
| InChI | InChI=1S/C23H19F3N4O4/c1-34-16-7-6-15-11-30(19(31)17(15)10-16)12-22(20(32)28-21(33)29-22)9-8-13-2-4-14(5-3-13)18(27)23(24,25)26/h2-7,10,18H,11-12,27H2,1H3,(H2,28,29,32,33)/t18?,22-/m1/s1 |
| InChIKey | JQKBKFPSZFKMLG-LMNIDFBRSA-N |
| XLogP | 1.84 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|