C26H21N5O5 — CID 46200570
(5R)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-[6-(6-methyl-2-oxo-1H-pyridin-3-yl)-3-pyridinyl]ethynyl]imidazolidine-2,4-dione (PubChem CID 46200570) has the molecular formula C26H21N5O5 and a molecular weight of 483.48 g/mol. Its IUPAC name is (5R)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-[6-(6-methyl-2-oxo-1H-pyridin-3-yl)-3-pyridinyl]ethynyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-[6-(6-methyl-2-oxo-1H-pyridin-3-yl)-3-pyridinyl]ethynyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 46200570 |
| Molecular Formula | C26H21N5O5 |
| Molecular Weight | 483.48 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | (5R)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-[6-(6-methyl-2-oxo-1H-pyridin-3-yl)-3-pyridinyl]ethynyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc2c(c1)C(=O)N(C[C@@]1(C#Cc3ccc(-c4ccc(C)[nH]c4=O)nc3)NC(=O)NC1=O)C2 |
| InChI | InChI=1S/C26H21N5O5/c1-15-3-7-19(22(32)28-15)21-8-4-16(12-27-21)9-10-26(24(34)29-25(35)30-26)14-31-13-17-5-6-18(36-2)11-20(17)23(31)33/h3-8,11-12H,13-14H2,1-2H3,(H,28,32)(H2,29,30,34,35)/t26-/m1/s1 |
| InChIKey | LLYJCPKPOUWCMM-AREMUKBSSA-N |
| XLogP | 1.34 |
| TPSA | 133.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.48 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|