C19H8F7NO4S — CID 46200812
3-[[2,3,5,6-tetrafluoro-4-[3-(trifluoromethoxy)phenyl]phenyl]carbamoyl]thiophene-2-carboxylic acid (PubChem CID 46200812) has the molecular formula C19H8F7NO4S and a molecular weight of 479.33 g/mol. Its IUPAC name is 3-[[2,3,5,6-tetrafluoro-4-[3-(trifluoromethoxy)phenyl]phenyl]carbamoyl]thiophene-2-carboxylic acid.
| Compound Name | 3-[[2,3,5,6-tetrafluoro-4-[3-(trifluoromethoxy)phenyl]phenyl]carbamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 46200812 |
| Molecular Formula | C19H8F7NO4S |
| Molecular Weight | 479.33 g/mol |
| Exact Mass | 479.01 |
| IUPAC Name | 3-[[2,3,5,6-tetrafluoro-4-[3-(trifluoromethoxy)phenyl]phenyl]carbamoyl]thiophene-2-carboxylic acid |
| SMILES | O=C(Nc1c(F)c(F)c(-c2cccc(OC(F)(F)F)c2)c(F)c1F)c1ccsc1C(=O)O |
| InChI | InChI=1S/C19H8F7NO4S/c20-11-10(7-2-1-3-8(6-7)31-19(24,25)26)12(21)14(23)15(13(11)22)27-17(28)9-4-5-32-16(9)18(29)30/h1-6H,(H,27,28)(H,29,30) |
| InChIKey | VNDUHYWEWRRBFJ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.33 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|