C18H17ClFN3O2 — CID 46200848
N'-(4-chloro-3-fluorophenyl)-N-(1,2,3,4-tetrahydroisoquinolin-1-ylmethyl)oxamide (PubChem CID 46200848) has the molecular formula C18H17ClFN3O2 and a molecular weight of 361.80 g/mol. Its IUPAC name is N'-(4-chloro-3-fluorophenyl)-N-(1,2,3,4-tetrahydroisoquinolin-1-ylmethyl)oxamide.
| Compound Name | N'-(4-chloro-3-fluorophenyl)-N-(1,2,3,4-tetrahydroisoquinolin-1-ylmethyl)oxamide |
|---|---|
| PubChem CID | 46200848 |
| Molecular Formula | C18H17ClFN3O2 |
| Molecular Weight | 361.80 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | N'-(4-chloro-3-fluorophenyl)-N-(1,2,3,4-tetrahydroisoquinolin-1-ylmethyl)oxamide |
| SMILES | O=C(NCC1NCCc2ccccc21)C(=O)Nc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C18H17ClFN3O2/c19-14-6-5-12(9-15(14)20)23-18(25)17(24)22-10-16-13-4-2-1-3-11(13)7-8-21-16/h1-6,9,16,21H,7-8,10H2,(H,22,24)(H,23,25) |
| InChIKey | REQBBGSBIRNOFT-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.80 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|