C27H20N6O4 — CID 46200888
(5R)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-(3-pyridin-4-yl-1H-indazol-6-yl)ethynyl]imidazolidine-2,4-dione (PubChem CID 46200888) has the molecular formula C27H20N6O4 and a molecular weight of 492.50 g/mol. Its IUPAC name is (5R)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-(3-pyridin-4-yl-1H-indazol-6-yl)ethynyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-(3-pyridin-4-yl-1H-indazol-6-yl)ethynyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 46200888 |
| Molecular Formula | C27H20N6O4 |
| Molecular Weight | 492.50 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | (5R)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-(3-pyridin-4-yl-1H-indazol-6-yl)ethynyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc2c(c1)C(=O)N(C[C@@]1(C#Cc3ccc4c(-c5ccncc5)n[nH]c4c3)NC(=O)NC1=O)C2 |
| InChI | InChI=1S/C27H20N6O4/c1-37-19-4-3-18-14-33(24(34)21(18)13-19)15-27(25(35)29-26(36)30-27)9-6-16-2-5-20-22(12-16)31-32-23(20)17-7-10-28-11-8-17/h2-5,7-8,10-13H,14-15H2,1H3,(H,31,32)(H2,29,30,35,36)/t27-/m1/s1 |
| InChIKey | WNNKWLPJIVJPIG-HHHXNRCGSA-N |
| XLogP | 2.22 |
| TPSA | 129.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.50 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|