C26H27N5O4 — CID 46200889
(5R)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-[6-(1-methylpiperidin-4-yl)-3-pyridinyl]ethynyl]imidazolidine-2,4-dione (PubChem CID 46200889) has the molecular formula C26H27N5O4 and a molecular weight of 473.53 g/mol. Its IUPAC name is (5R)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-[6-(1-methylpiperidin-4-yl)-3-pyridinyl]ethynyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-[6-(1-methylpiperidin-4-yl)-3-pyridinyl]ethynyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 46200889 |
| Molecular Formula | C26H27N5O4 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | (5R)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-[6-(1-methylpiperidin-4-yl)-3-pyridinyl]ethynyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc2c(c1)C(=O)N(C[C@@]1(C#Cc3ccc(C4CCN(C)CC4)nc3)NC(=O)NC1=O)C2 |
| InChI | InChI=1S/C26H27N5O4/c1-30-11-8-18(9-12-30)22-6-3-17(14-27-22)7-10-26(24(33)28-25(34)29-26)16-31-15-19-4-5-20(35-2)13-21(19)23(31)32/h3-6,13-14,18H,8-9,11-12,15-16H2,1-2H3,(H2,28,29,33,34)/t26-/m1/s1 |
| InChIKey | OYOALWYHSLCCJW-AREMUKBSSA-N |
| XLogP | 1.49 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|