C13H11Br2NO2 — CID 46200907
(2E)-2-(4,5-dibromo-1,2,6,7-tetrahydrocyclopenta[e][1]benzofuran-8-ylidene)acetamide (PubChem CID 46200907) has the molecular formula C13H11Br2NO2 and a molecular weight of 373.04 g/mol. Its IUPAC name is (2E)-2-(4,5-dibromo-1,2,6,7-tetrahydrocyclopenta[e][1]benzofuran-8-ylidene)acetamide.
| Compound Name | (2E)-2-(4,5-dibromo-1,2,6,7-tetrahydrocyclopenta[e][1]benzofuran-8-ylidene)acetamide |
|---|---|
| PubChem CID | 46200907 |
| Molecular Formula | C13H11Br2NO2 |
| Molecular Weight | 373.04 g/mol |
| Exact Mass | 370.92 |
| IUPAC Name | (2E)-2-(4,5-dibromo-1,2,6,7-tetrahydrocyclopenta[e][1]benzofuran-8-ylidene)acetamide |
| SMILES | NC(=O)/C=C1\CCc2c(Br)c(Br)c3c(c21)CCO3 |
| InChI | InChI=1S/C13H11Br2NO2/c14-11-7-2-1-6(5-9(16)17)10(7)8-3-4-18-13(8)12(11)15/h5H,1-4H2,(H2,16,17)/b6-5+ |
| InChIKey | IKIVPISPJHJGNY-AATRIKPKSA-N |
| XLogP | 2.96 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.04 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|