C13H9Br2NO — CID 46200910
(2E)-2-(4,5-dibromo-1,2,6,7-tetrahydrocyclopenta[e][1]benzofuran-8-ylidene)acetonitrile (PubChem CID 46200910) has the molecular formula C13H9Br2NO and a molecular weight of 355.03 g/mol. Its IUPAC name is (2E)-2-(4,5-dibromo-1,2,6,7-tetrahydrocyclopenta[e][1]benzofuran-8-ylidene)acetonitrile.
| Compound Name | (2E)-2-(4,5-dibromo-1,2,6,7-tetrahydrocyclopenta[e][1]benzofuran-8-ylidene)acetonitrile |
|---|---|
| PubChem CID | 46200910 |
| Molecular Formula | C13H9Br2NO |
| Molecular Weight | 355.03 g/mol |
| Exact Mass | 352.91 |
| IUPAC Name | (2E)-2-(4,5-dibromo-1,2,6,7-tetrahydrocyclopenta[e][1]benzofuran-8-ylidene)acetonitrile |
| SMILES | N#C/C=C1\CCc2c(Br)c(Br)c3c(c21)CCO3 |
| InChI | InChI=1S/C13H9Br2NO/c14-11-8-2-1-7(3-5-16)10(8)9-4-6-17-13(9)12(11)15/h3H,1-2,4,6H2/b7-3+ |
| InChIKey | LOIDLYZZLVBIFP-XVNBXDOJSA-N |
| XLogP | 4.00 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.03 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|