About (3E)-2-hydroxy-4,8-dimethylnona-3,7-dienenitrile
(3E)-2-hydroxy-4,8-dimethylnona-3,7-dienenitrile (PubChem CID 46201126) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is (3E)-2-hydroxy-4,8-dimethylnona-3,7-dienenitrile.
Molecular Properties
| Compound Name | (3E)-2-hydroxy-4,8-dimethylnona-3,7-dienenitrile |
| PubChem CID | 46201126 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | (3E)-2-hydroxy-4,8-dimethylnona-3,7-dienenitrile |
| SMILES | CC(C)=CCC/C(C)=C/C(O)C#N |
| InChI | InChI=1S/C11H17NO/c1-9(2)5-4-6-10(3)7-11(13)8-12/h5,7,11,13H,4,6H2,1-3H3/b10-7+ |
| InChIKey | MCEFGDNRDWFCAI-JXMROGBWSA-N |
| XLogP | 2.56 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-2-hydroxy-4,8-dimethylnona-3,7-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-2-hydroxy-4,8-dimethylnona-3,7-dienenitrile?
The IUPAC name of (3E)-2-hydroxy-4,8-dimethylnona-3,7-dienenitrile (CID 46201126) is (3E)-2-hydroxy-4,8-dimethylnona-3,7-dienenitrile.
What is the SMILES notation for (3E)-2-hydroxy-4,8-dimethylnona-3,7-dienenitrile?
The canonical SMILES for (3E)-2-hydroxy-4,8-dimethylnona-3,7-dienenitrile is CC(C)=CCC/C(C)=C/C(O)C#N.
What is the InChIKey of (3E)-2-hydroxy-4,8-dimethylnona-3,7-dienenitrile?
The InChIKey is MCEFGDNRDWFCAI-JXMROGBWSA-N. The full InChI is InChI=1S/C11H17NO/c1-9(2)5-4-6-10(3)7-11(13)8-12/h5,7,11,13H,4,6H2,1-3H3/b10-7+.
What are the key properties of (3E)-2-hydroxy-4,8-dimethylnona-3,7-dienenitrile?
(3E)-2-hydroxy-4,8-dimethylnona-3,7-dienenitrile has a molecular weight of 179.26 g/mol, XLogP of 2.56, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-2-hydroxy-4,8-dimethylnona-3,7-dienenitrile is sourced from PubChem (CID 46201126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).