(3R,4S)-4-(butylcarbamoyl)pyrrolidine-3-carboxylic acid

C10H18N2O3 — CID 46201148

IUPAC(3R,4S)-4-(butylcarbamoyl)pyrrolidine-3-carboxylic acid
SMILESCCCCNC(=O)[C@@H]1CNC[C@@H]1C(=O)O
InChIInChI=1S/C10H18N2O3/c1-2-3-4-12-9(13)7-5-11-6-8(7)10(14)15/h7-8,11H,2-6H2,1H3,(H,12,13)(H,14,15)/t7-,8+/m1/s1
InChIKeyNFEXKHRBDJQYFO-SFYZADRCSA-N
MW214.26 g/mol
LogP-0.18
Rot. Bonds5

About (3R,4S)-4-(butylcarbamoyl)pyrrolidine-3-carboxylic acid

(3R,4S)-4-(butylcarbamoyl)pyrrolidine-3-carboxylic acid (PubChem CID 46201148) has the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. Its IUPAC name is (3R,4S)-4-(butylcarbamoyl)pyrrolidine-3-carboxylic acid.

Molecular Properties

Compound Name(3R,4S)-4-(butylcarbamoyl)pyrrolidine-3-carboxylic acid
PubChem CID46201148
Molecular FormulaC10H18N2O3
Molecular Weight214.26 g/mol
Exact Mass214.13
IUPAC Name(3R,4S)-4-(butylcarbamoyl)pyrrolidine-3-carboxylic acid
SMILESCCCCNC(=O)[C@@H]1CNC[C@@H]1C(=O)O
InChIInChI=1S/C10H18N2O3/c1-2-3-4-12-9(13)7-5-11-6-8(7)10(14)15/h7-8,11H,2-6H2,1H3,(H,12,13)(H,14,15)/t7-,8+/m1/s1
InChIKeyNFEXKHRBDJQYFO-SFYZADRCSA-N
XLogP-0.18
TPSA78.43 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.26
LogP ≤ 5-0.18
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze (3R,4S)-4-(butylcarbamoyl)pyrrolidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3R,4S)-4-(butylcarbamoyl)pyrrolidine-3-carboxylic acid?
The IUPAC name of (3R,4S)-4-(butylcarbamoyl)pyrrolidine-3-carboxylic acid (CID 46201148) is (3R,4S)-4-(butylcarbamoyl)pyrrolidine-3-carboxylic acid.
What is the SMILES notation for (3R,4S)-4-(butylcarbamoyl)pyrrolidine-3-carboxylic acid?
The canonical SMILES for (3R,4S)-4-(butylcarbamoyl)pyrrolidine-3-carboxylic acid is CCCCNC(=O)[C@@H]1CNC[C@@H]1C(=O)O.
What is the InChIKey of (3R,4S)-4-(butylcarbamoyl)pyrrolidine-3-carboxylic acid?
The InChIKey is NFEXKHRBDJQYFO-SFYZADRCSA-N. The full InChI is InChI=1S/C10H18N2O3/c1-2-3-4-12-9(13)7-5-11-6-8(7)10(14)15/h7-8,11H,2-6H2,1H3,(H,12,13)(H,14,15)/t7-,8+/m1/s1.
What are the key properties of (3R,4S)-4-(butylcarbamoyl)pyrrolidine-3-carboxylic acid?
(3R,4S)-4-(butylcarbamoyl)pyrrolidine-3-carboxylic acid has a molecular weight of 214.26 g/mol, XLogP of -0.18, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-4-(butylcarbamoyl)pyrrolidine-3-carboxylic acid is sourced from PubChem (CID 46201148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).