About benzyl (4S)-2-(3-fluorophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylate
benzyl (4S)-2-(3-fluorophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylate (PubChem CID 46201210) has the molecular formula C17H14FNO3
and a molecular weight of 299.30 g/mol. Its IUPAC name is benzyl (4S)-2-(3-fluorophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | benzyl (4S)-2-(3-fluorophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylate |
| PubChem CID | 46201210 |
| Molecular Formula | C17H14FNO3 |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | benzyl (4S)-2-(3-fluorophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylate |
| SMILES | O=C(OCc1ccccc1)[C@@H]1COC(c2cccc(F)c2)=N1 |
| InChI | InChI=1S/C17H14FNO3/c18-14-8-4-7-13(9-14)16-19-15(11-21-16)17(20)22-10-12-5-2-1-3-6-12/h1-9,15H,10-11H2/t15-/m0/s1 |
| InChIKey | XGDJJZZGMUXDFT-HNNXBMFYSA-N |
| XLogP | 2.71 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzyl (4S)-2-(3-fluorophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl (4S)-2-(3-fluorophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylate?
The IUPAC name of benzyl (4S)-2-(3-fluorophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylate (CID 46201210) is benzyl (4S)-2-(3-fluorophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylate.
What is the SMILES notation for benzyl (4S)-2-(3-fluorophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylate?
The canonical SMILES for benzyl (4S)-2-(3-fluorophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylate is O=C(OCc1ccccc1)[C@@H]1COC(c2cccc(F)c2)=N1.
What is the InChIKey of benzyl (4S)-2-(3-fluorophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylate?
The InChIKey is XGDJJZZGMUXDFT-HNNXBMFYSA-N. The full InChI is InChI=1S/C17H14FNO3/c18-14-8-4-7-13(9-14)16-19-15(11-21-16)17(20)22-10-12-5-2-1-3-6-12/h1-9,15H,10-11H2/t15-/m0/s1.
What are the key properties of benzyl (4S)-2-(3-fluorophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylate?
benzyl (4S)-2-(3-fluorophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylate has a molecular weight of 299.30 g/mol, XLogP of 2.71, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (4S)-2-(3-fluorophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 46201210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).