About benzyl (4S)-2-(4-fluoro-3-nitrophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylate
benzyl (4S)-2-(4-fluoro-3-nitrophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylate (PubChem CID 46201213) has the molecular formula C17H13FN2O5
and a molecular weight of 344.30 g/mol. Its IUPAC name is benzyl (4S)-2-(4-fluoro-3-nitrophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | benzyl (4S)-2-(4-fluoro-3-nitrophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylate |
| PubChem CID | 46201213 |
| Molecular Formula | C17H13FN2O5 |
| Molecular Weight | 344.30 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | benzyl (4S)-2-(4-fluoro-3-nitrophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylate |
| SMILES | O=C(OCc1ccccc1)[C@@H]1COC(c2ccc(F)c([N+](=O)[O-])c2)=N1 |
| InChI | InChI=1S/C17H13FN2O5/c18-13-7-6-12(8-15(13)20(22)23)16-19-14(10-24-16)17(21)25-9-11-4-2-1-3-5-11/h1-8,14H,9-10H2/t14-/m0/s1 |
| InChIKey | HVBDNTJTSIKQOG-AWEZNQCLSA-N |
| XLogP | 2.62 |
| TPSA | 91.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzyl (4S)-2-(4-fluoro-3-nitrophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl (4S)-2-(4-fluoro-3-nitrophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylate?
The IUPAC name of benzyl (4S)-2-(4-fluoro-3-nitrophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylate (CID 46201213) is benzyl (4S)-2-(4-fluoro-3-nitrophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylate.
What is the SMILES notation for benzyl (4S)-2-(4-fluoro-3-nitrophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylate?
The canonical SMILES for benzyl (4S)-2-(4-fluoro-3-nitrophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylate is O=C(OCc1ccccc1)[C@@H]1COC(c2ccc(F)c([N+](=O)[O-])c2)=N1.
What is the InChIKey of benzyl (4S)-2-(4-fluoro-3-nitrophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylate?
The InChIKey is HVBDNTJTSIKQOG-AWEZNQCLSA-N. The full InChI is InChI=1S/C17H13FN2O5/c18-13-7-6-12(8-15(13)20(22)23)16-19-14(10-24-16)17(21)25-9-11-4-2-1-3-5-11/h1-8,14H,9-10H2/t14-/m0/s1.
What are the key properties of benzyl (4S)-2-(4-fluoro-3-nitrophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylate?
benzyl (4S)-2-(4-fluoro-3-nitrophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylate has a molecular weight of 344.30 g/mol, XLogP of 2.62, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (4S)-2-(4-fluoro-3-nitrophenyl)-4,5-dihydro-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 46201213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).