About benzyl (4S)-2-(5-bromo-3-pyridinyl)-4,5-dihydro-1,3-oxazole-4-carboxylate
benzyl (4S)-2-(5-bromo-3-pyridinyl)-4,5-dihydro-1,3-oxazole-4-carboxylate (PubChem CID 46201249) has the molecular formula C16H13BrN2O3
and a molecular weight of 361.19 g/mol. Its IUPAC name is benzyl (4S)-2-(5-bromo-3-pyridinyl)-4,5-dihydro-1,3-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | benzyl (4S)-2-(5-bromo-3-pyridinyl)-4,5-dihydro-1,3-oxazole-4-carboxylate |
| PubChem CID | 46201249 |
| Molecular Formula | C16H13BrN2O3 |
| Molecular Weight | 361.19 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | benzyl (4S)-2-(5-bromo-3-pyridinyl)-4,5-dihydro-1,3-oxazole-4-carboxylate |
| SMILES | O=C(OCc1ccccc1)[C@@H]1COC(c2cncc(Br)c2)=N1 |
| InChI | InChI=1S/C16H13BrN2O3/c17-13-6-12(7-18-8-13)15-19-14(10-21-15)16(20)22-9-11-4-2-1-3-5-11/h1-8,14H,9-10H2/t14-/m0/s1 |
| InChIKey | GCLHDNHFQIRXDI-AWEZNQCLSA-N |
| XLogP | 2.73 |
| TPSA | 60.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.19 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze benzyl (4S)-2-(5-bromo-3-pyridinyl)-4,5-dihydro-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl (4S)-2-(5-bromo-3-pyridinyl)-4,5-dihydro-1,3-oxazole-4-carboxylate?
The IUPAC name of benzyl (4S)-2-(5-bromo-3-pyridinyl)-4,5-dihydro-1,3-oxazole-4-carboxylate (CID 46201249) is benzyl (4S)-2-(5-bromo-3-pyridinyl)-4,5-dihydro-1,3-oxazole-4-carboxylate.
What is the SMILES notation for benzyl (4S)-2-(5-bromo-3-pyridinyl)-4,5-dihydro-1,3-oxazole-4-carboxylate?
The canonical SMILES for benzyl (4S)-2-(5-bromo-3-pyridinyl)-4,5-dihydro-1,3-oxazole-4-carboxylate is O=C(OCc1ccccc1)[C@@H]1COC(c2cncc(Br)c2)=N1.
What is the InChIKey of benzyl (4S)-2-(5-bromo-3-pyridinyl)-4,5-dihydro-1,3-oxazole-4-carboxylate?
The InChIKey is GCLHDNHFQIRXDI-AWEZNQCLSA-N. The full InChI is InChI=1S/C16H13BrN2O3/c17-13-6-12(7-18-8-13)15-19-14(10-21-15)16(20)22-9-11-4-2-1-3-5-11/h1-8,14H,9-10H2/t14-/m0/s1.
What are the key properties of benzyl (4S)-2-(5-bromo-3-pyridinyl)-4,5-dihydro-1,3-oxazole-4-carboxylate?
benzyl (4S)-2-(5-bromo-3-pyridinyl)-4,5-dihydro-1,3-oxazole-4-carboxylate has a molecular weight of 361.19 g/mol, XLogP of 2.73, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (4S)-2-(5-bromo-3-pyridinyl)-4,5-dihydro-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 46201249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).