About benzyl 2-(3-chlorophenyl)-1,3-oxazole-4-carboxylate
benzyl 2-(3-chlorophenyl)-1,3-oxazole-4-carboxylate (PubChem CID 46201382) has the molecular formula C17H12ClNO3
and a molecular weight of 313.74 g/mol. Its IUPAC name is benzyl 2-(3-chlorophenyl)-1,3-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | benzyl 2-(3-chlorophenyl)-1,3-oxazole-4-carboxylate |
| PubChem CID | 46201382 |
| Molecular Formula | C17H12ClNO3 |
| Molecular Weight | 313.74 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | benzyl 2-(3-chlorophenyl)-1,3-oxazole-4-carboxylate |
| SMILES | O=C(OCc1ccccc1)c1coc(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C17H12ClNO3/c18-14-8-4-7-13(9-14)16-19-15(11-21-16)17(20)22-10-12-5-2-1-3-6-12/h1-9,11H,10H2 |
| InChIKey | JCQNBHHTVDGLEY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.74 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzyl 2-(3-chlorophenyl)-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-(3-chlorophenyl)-1,3-oxazole-4-carboxylate?
The IUPAC name of benzyl 2-(3-chlorophenyl)-1,3-oxazole-4-carboxylate (CID 46201382) is benzyl 2-(3-chlorophenyl)-1,3-oxazole-4-carboxylate.
What is the SMILES notation for benzyl 2-(3-chlorophenyl)-1,3-oxazole-4-carboxylate?
The canonical SMILES for benzyl 2-(3-chlorophenyl)-1,3-oxazole-4-carboxylate is O=C(OCc1ccccc1)c1coc(-c2cccc(Cl)c2)n1.
What is the InChIKey of benzyl 2-(3-chlorophenyl)-1,3-oxazole-4-carboxylate?
The InChIKey is JCQNBHHTVDGLEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12ClNO3/c18-14-8-4-7-13(9-14)16-19-15(11-21-16)17(20)22-10-12-5-2-1-3-6-12/h1-9,11H,10H2.
What are the key properties of benzyl 2-(3-chlorophenyl)-1,3-oxazole-4-carboxylate?
benzyl 2-(3-chlorophenyl)-1,3-oxazole-4-carboxylate has a molecular weight of 313.74 g/mol, XLogP of 4.35, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-(3-chlorophenyl)-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 46201382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).