C6H6O3S — CID 46201434
(3aS,6aR)-3a,4,6,6a-tetrahydrothieno[3,4-c]furan-1,3-dione (PubChem CID 46201434) has the molecular formula C6H6O3S and a molecular weight of 158.18 g/mol. Its IUPAC name is (3aS,6aR)-3a,4,6,6a-tetrahydrothieno[3,4-c]furan-1,3-dione.
| Compound Name | (3aS,6aR)-3a,4,6,6a-tetrahydrothieno[3,4-c]furan-1,3-dione |
|---|---|
| PubChem CID | 46201434 |
| Molecular Formula | C6H6O3S |
| Molecular Weight | 158.18 g/mol |
| Exact Mass | 158.00 |
| IUPAC Name | (3aS,6aR)-3a,4,6,6a-tetrahydrothieno[3,4-c]furan-1,3-dione |
| SMILES | O=C1OC(=O)[C@@H]2CSC[C@H]12 |
| InChI | InChI=1S/C6H6O3S/c7-5-3-1-10-2-4(3)6(8)9-5/h3-4H,1-2H2/t3-,4+ |
| InChIKey | QPUHIMKBVJKERM-ZXZARUISSA-N |
| XLogP | 0.05 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.18 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|