C19H25N3O3 — CID 46201578
(3aR,6aS)-2-benzyl-5-(2-morpholin-4-ylethyl)-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,6-dione (PubChem CID 46201578) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is (3aR,6aS)-2-benzyl-5-(2-morpholin-4-ylethyl)-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,6-dione.
| Compound Name | (3aR,6aS)-2-benzyl-5-(2-morpholin-4-ylethyl)-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 46201578 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | (3aR,6aS)-2-benzyl-5-(2-morpholin-4-ylethyl)-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,6-dione |
| SMILES | O=C1[C@H]2CN(Cc3ccccc3)C[C@H]2C(=O)N1CCN1CCOCC1 |
| InChI | InChI=1S/C19H25N3O3/c23-18-16-13-21(12-15-4-2-1-3-5-15)14-17(16)19(24)22(18)7-6-20-8-10-25-11-9-20/h1-5,16-17H,6-14H2/t16-,17+ |
| InChIKey | GQJCVGOGPLDWIM-CALCHBBNSA-N |
| XLogP | 0.44 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|