C16H20N2O3 — CID 46201580
(3aS,6aR)-2-benzyl-5-(3-hydroxypropyl)-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,6-dione (PubChem CID 46201580) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is (3aS,6aR)-2-benzyl-5-(3-hydroxypropyl)-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,6-dione.
| Compound Name | (3aS,6aR)-2-benzyl-5-(3-hydroxypropyl)-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 46201580 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | (3aS,6aR)-2-benzyl-5-(3-hydroxypropyl)-1,3,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,6-dione |
| SMILES | O=C1[C@H]2CN(Cc3ccccc3)C[C@H]2C(=O)N1CCCO |
| InChI | InChI=1S/C16H20N2O3/c19-8-4-7-18-15(20)13-10-17(11-14(13)16(18)21)9-12-5-2-1-3-6-12/h1-3,5-6,13-14,19H,4,7-11H2/t13-,14+ |
| InChIKey | RJTDYQXCIRQBHJ-OKILXGFUSA-N |
| XLogP | 0.49 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|