About benzyl 2-(2-phenoxy-3-pyridinyl)-1,3-oxazole-4-carboxylate
benzyl 2-(2-phenoxy-3-pyridinyl)-1,3-oxazole-4-carboxylate (PubChem CID 46201658) has the molecular formula C22H16N2O4
and a molecular weight of 372.38 g/mol. Its IUPAC name is benzyl 2-(2-phenoxy-3-pyridinyl)-1,3-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | benzyl 2-(2-phenoxy-3-pyridinyl)-1,3-oxazole-4-carboxylate |
| PubChem CID | 46201658 |
| Molecular Formula | C22H16N2O4 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | benzyl 2-(2-phenoxy-3-pyridinyl)-1,3-oxazole-4-carboxylate |
| SMILES | O=C(OCc1ccccc1)c1coc(-c2cccnc2Oc2ccccc2)n1 |
| InChI | InChI=1S/C22H16N2O4/c25-22(27-14-16-8-3-1-4-9-16)19-15-26-21(24-19)18-12-7-13-23-20(18)28-17-10-5-2-6-11-17/h1-13,15H,14H2 |
| InChIKey | OYIIJYVNXNZVPX-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze benzyl 2-(2-phenoxy-3-pyridinyl)-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-(2-phenoxy-3-pyridinyl)-1,3-oxazole-4-carboxylate?
The IUPAC name of benzyl 2-(2-phenoxy-3-pyridinyl)-1,3-oxazole-4-carboxylate (CID 46201658) is benzyl 2-(2-phenoxy-3-pyridinyl)-1,3-oxazole-4-carboxylate.
What is the SMILES notation for benzyl 2-(2-phenoxy-3-pyridinyl)-1,3-oxazole-4-carboxylate?
The canonical SMILES for benzyl 2-(2-phenoxy-3-pyridinyl)-1,3-oxazole-4-carboxylate is O=C(OCc1ccccc1)c1coc(-c2cccnc2Oc2ccccc2)n1.
What is the InChIKey of benzyl 2-(2-phenoxy-3-pyridinyl)-1,3-oxazole-4-carboxylate?
The InChIKey is OYIIJYVNXNZVPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16N2O4/c25-22(27-14-16-8-3-1-4-9-16)19-15-26-21(24-19)18-12-7-13-23-20(18)28-17-10-5-2-6-11-17/h1-13,15H,14H2.
What are the key properties of benzyl 2-(2-phenoxy-3-pyridinyl)-1,3-oxazole-4-carboxylate?
benzyl 2-(2-phenoxy-3-pyridinyl)-1,3-oxazole-4-carboxylate has a molecular weight of 372.38 g/mol, XLogP of 4.89, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-(2-phenoxy-3-pyridinyl)-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 46201658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).