C10H16N2O2S — CID 46201744
(3aS,6aR)-5-[2-(dimethylamino)ethyl]-1,3,3a,6a-tetrahydrothieno[3,4-c]pyrrole-4,6-dione (PubChem CID 46201744) has the molecular formula C10H16N2O2S and a molecular weight of 228.32 g/mol. Its IUPAC name is (3aS,6aR)-5-[2-(dimethylamino)ethyl]-1,3,3a,6a-tetrahydrothieno[3,4-c]pyrrole-4,6-dione.
| Compound Name | (3aS,6aR)-5-[2-(dimethylamino)ethyl]-1,3,3a,6a-tetrahydrothieno[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 46201744 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | (3aS,6aR)-5-[2-(dimethylamino)ethyl]-1,3,3a,6a-tetrahydrothieno[3,4-c]pyrrole-4,6-dione |
| SMILES | CN(C)CCN1C(=O)[C@H]2CSC[C@H]2C1=O |
| InChI | InChI=1S/C10H16N2O2S/c1-11(2)3-4-12-9(13)7-5-15-6-8(7)10(12)14/h7-8H,3-6H2,1-2H3/t7-,8+ |
| InChIKey | BOMZWRFQODVVPQ-OCAPTIKFSA-N |
| XLogP | -0.10 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|