C10H15NO2S — CID 46201749
(3aS,6aR)-5-butyl-1,3,3a,6a-tetrahydrothieno[3,4-c]pyrrole-4,6-dione (PubChem CID 46201749) has the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. Its IUPAC name is (3aS,6aR)-5-butyl-1,3,3a,6a-tetrahydrothieno[3,4-c]pyrrole-4,6-dione.
| Compound Name | (3aS,6aR)-5-butyl-1,3,3a,6a-tetrahydrothieno[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 46201749 |
| Molecular Formula | C10H15NO2S |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | (3aS,6aR)-5-butyl-1,3,3a,6a-tetrahydrothieno[3,4-c]pyrrole-4,6-dione |
| SMILES | CCCCN1C(=O)[C@H]2CSC[C@H]2C1=O |
| InChI | InChI=1S/C10H15NO2S/c1-2-3-4-11-9(12)7-5-14-6-8(7)10(11)13/h7-8H,2-6H2,1H3/t7-,8+ |
| InChIKey | QCWXMZPKEOFJOS-OCAPTIKFSA-N |
| XLogP | 1.13 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|