C18H24N4O3 — CID 46201881
(3S)-2-[(2S)-2,6-diaminohexanoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid (PubChem CID 46201881) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is (3S)-2-[(2S)-2,6-diaminohexanoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid.
| Compound Name | (3S)-2-[(2S)-2,6-diaminohexanoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 46201881 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | (3S)-2-[(2S)-2,6-diaminohexanoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid |
| SMILES | NCCCC[C@H](N)C(=O)N1Cc2[nH]c3ccccc3c2C[C@H]1C(=O)O |
| InChI | InChI=1S/C18H24N4O3/c19-8-4-3-6-13(20)17(23)22-10-15-12(9-16(22)18(24)25)11-5-1-2-7-14(11)21-15/h1-2,5,7,13,16,21H,3-4,6,8-10,19-20H2,(H,24,25)/t13-,16-/m0/s1 |
| InChIKey | IEXQBOXLENLLBE-BBRMVZONSA-N |
| XLogP | 0.96 |
| TPSA | 125.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|