C18H23N3O3 — CID 46201884
(3S)-2-[(2S)-2-amino-4-methylpentanoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid (PubChem CID 46201884) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is (3S)-2-[(2S)-2-amino-4-methylpentanoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid.
| Compound Name | (3S)-2-[(2S)-2-amino-4-methylpentanoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 46201884 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | (3S)-2-[(2S)-2-amino-4-methylpentanoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid |
| SMILES | CC(C)C[C@H](N)C(=O)N1Cc2[nH]c3ccccc3c2C[C@H]1C(=O)O |
| InChI | InChI=1S/C18H23N3O3/c1-10(2)7-13(19)17(22)21-9-15-12(8-16(21)18(23)24)11-5-3-4-6-14(11)20-15/h3-6,10,13,16,20H,7-9,19H2,1-2H3,(H,23,24)/t13-,16-/m0/s1 |
| InChIKey | JUSUHLAKNFIDFC-BBRMVZONSA-N |
| XLogP | 1.88 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|