About (3-chloro-1,4-dimethyl-2,5-dioxoimidazolidin-4-yl)methyl-trimethylazanium
(3-chloro-1,4-dimethyl-2,5-dioxoimidazolidin-4-yl)methyl-trimethylazanium (PubChem CID 46202004) has the molecular formula C9H17ClN3O2+
and a molecular weight of 234.71 g/mol. Its IUPAC name is (3-chloro-1,4-dimethyl-2,5-dioxoimidazolidin-4-yl)methyl-trimethylazanium.
Molecular Properties
| Compound Name | (3-chloro-1,4-dimethyl-2,5-dioxoimidazolidin-4-yl)methyl-trimethylazanium |
| PubChem CID | 46202004 |
| Molecular Formula | C9H17ClN3O2+ |
| Molecular Weight | 234.71 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | (3-chloro-1,4-dimethyl-2,5-dioxoimidazolidin-4-yl)methyl-trimethylazanium |
| SMILES | CN1C(=O)N(Cl)C(C)(C[N+](C)(C)C)C1=O |
| InChI | InChI=1S/C9H17ClN3O2/c1-9(6-13(3,4)5)7(14)11(2)8(15)12(9)10/h6H2,1-5H3/q+1 |
| InChIKey | FICIOZBBNIRYKY-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.71 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (3-chloro-1,4-dimethyl-2,5-dioxoimidazolidin-4-yl)methyl-trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chloro-1,4-dimethyl-2,5-dioxoimidazolidin-4-yl)methyl-trimethylazanium?
The IUPAC name of (3-chloro-1,4-dimethyl-2,5-dioxoimidazolidin-4-yl)methyl-trimethylazanium (CID 46202004) is (3-chloro-1,4-dimethyl-2,5-dioxoimidazolidin-4-yl)methyl-trimethylazanium.
What is the SMILES notation for (3-chloro-1,4-dimethyl-2,5-dioxoimidazolidin-4-yl)methyl-trimethylazanium?
The canonical SMILES for (3-chloro-1,4-dimethyl-2,5-dioxoimidazolidin-4-yl)methyl-trimethylazanium is CN1C(=O)N(Cl)C(C)(C[N+](C)(C)C)C1=O.
What is the InChIKey of (3-chloro-1,4-dimethyl-2,5-dioxoimidazolidin-4-yl)methyl-trimethylazanium?
The InChIKey is FICIOZBBNIRYKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17ClN3O2/c1-9(6-13(3,4)5)7(14)11(2)8(15)12(9)10/h6H2,1-5H3/q+1.
What are the key properties of (3-chloro-1,4-dimethyl-2,5-dioxoimidazolidin-4-yl)methyl-trimethylazanium?
(3-chloro-1,4-dimethyl-2,5-dioxoimidazolidin-4-yl)methyl-trimethylazanium has a molecular weight of 234.71 g/mol, XLogP of 0.50, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chloro-1,4-dimethyl-2,5-dioxoimidazolidin-4-yl)methyl-trimethylazanium is sourced from PubChem (CID 46202004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).