About 3-chloro-8,8-dimethyl-1-oxa-3-aza-8-azoniaspiro[4.5]decan-2-one
3-chloro-8,8-dimethyl-1-oxa-3-aza-8-azoniaspiro[4.5]decan-2-one (PubChem CID 46202014) has the molecular formula C9H16ClN2O2+
and a molecular weight of 219.69 g/mol. Its IUPAC name is 3-chloro-8,8-dimethyl-1-oxa-3-aza-8-azoniaspiro[4.5]decan-2-one.
Molecular Properties
| Compound Name | 3-chloro-8,8-dimethyl-1-oxa-3-aza-8-azoniaspiro[4.5]decan-2-one |
| PubChem CID | 46202014 |
| Molecular Formula | C9H16ClN2O2+ |
| Molecular Weight | 219.69 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 3-chloro-8,8-dimethyl-1-oxa-3-aza-8-azoniaspiro[4.5]decan-2-one |
| SMILES | C[N+]1(C)CCC2(CC1)CN(Cl)C(=O)O2 |
| InChI | InChI=1S/C9H16ClN2O2/c1-12(2)5-3-9(4-6-12)7-11(10)8(13)14-9/h3-7H2,1-2H3/q+1 |
| InChIKey | ULJXOHIQVWFQJJ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.69 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-8,8-dimethyl-1-oxa-3-aza-8-azoniaspiro[4.5]decan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-8,8-dimethyl-1-oxa-3-aza-8-azoniaspiro[4.5]decan-2-one?
The IUPAC name of 3-chloro-8,8-dimethyl-1-oxa-3-aza-8-azoniaspiro[4.5]decan-2-one (CID 46202014) is 3-chloro-8,8-dimethyl-1-oxa-3-aza-8-azoniaspiro[4.5]decan-2-one.
What is the SMILES notation for 3-chloro-8,8-dimethyl-1-oxa-3-aza-8-azoniaspiro[4.5]decan-2-one?
The canonical SMILES for 3-chloro-8,8-dimethyl-1-oxa-3-aza-8-azoniaspiro[4.5]decan-2-one is C[N+]1(C)CCC2(CC1)CN(Cl)C(=O)O2.
What is the InChIKey of 3-chloro-8,8-dimethyl-1-oxa-3-aza-8-azoniaspiro[4.5]decan-2-one?
The InChIKey is ULJXOHIQVWFQJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16ClN2O2/c1-12(2)5-3-9(4-6-12)7-11(10)8(13)14-9/h3-7H2,1-2H3/q+1.
What are the key properties of 3-chloro-8,8-dimethyl-1-oxa-3-aza-8-azoniaspiro[4.5]decan-2-one?
3-chloro-8,8-dimethyl-1-oxa-3-aza-8-azoniaspiro[4.5]decan-2-one has a molecular weight of 219.69 g/mol, XLogP of 1.20, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-8,8-dimethyl-1-oxa-3-aza-8-azoniaspiro[4.5]decan-2-one is sourced from PubChem (CID 46202014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).