C25H23ClF2N6O — CID 46202073
5-[(2-chloro-3,6-difluorophenyl)methyl]-3-[4-(2-imidazol-1-ylethoxy)phenyl]-6,7,8,9-tetrahydropyrazino[2,3-b][1,4]diazepine (PubChem CID 46202073) has the molecular formula C25H23ClF2N6O and a molecular weight of 496.95 g/mol. Its IUPAC name is 5-[(2-chloro-3,6-difluorophenyl)methyl]-3-[4-(2-imidazol-1-ylethoxy)phenyl]-6,7,8,9-tetrahydropyrazino[2,3-b][1,4]diazepine.
| Compound Name | 5-[(2-chloro-3,6-difluorophenyl)methyl]-3-[4-(2-imidazol-1-ylethoxy)phenyl]-6,7,8,9-tetrahydropyrazino[2,3-b][1,4]diazepine |
|---|---|
| PubChem CID | 46202073 |
| Molecular Formula | C25H23ClF2N6O |
| Molecular Weight | 496.95 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | 5-[(2-chloro-3,6-difluorophenyl)methyl]-3-[4-(2-imidazol-1-ylethoxy)phenyl]-6,7,8,9-tetrahydropyrazino[2,3-b][1,4]diazepine |
| SMILES | Fc1ccc(F)c(CN2CCCNc3ncc(-c4ccc(OCCn5ccnc5)cc4)nc32)c1Cl |
| InChI | InChI=1S/C25H23ClF2N6O/c26-23-19(20(27)6-7-21(23)28)15-34-10-1-8-30-24-25(34)32-22(14-31-24)17-2-4-18(5-3-17)35-13-12-33-11-9-29-16-33/h2-7,9,11,14,16H,1,8,10,12-13,15H2,(H,30,31) |
| InChIKey | FYPWDOLFQUYYPD-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.95 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|