C20H28O2 — CID 46202179
(E)-2-(4-methoxyphenyl)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-ol (PubChem CID 46202179) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is (E)-2-(4-methoxyphenyl)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-ol.
| Compound Name | (E)-2-(4-methoxyphenyl)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-ol |
|---|---|
| PubChem CID | 46202179 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | (E)-2-(4-methoxyphenyl)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-ol |
| SMILES | COc1ccc(C(C)(O)/C=C/C2C(C)=CCCC2(C)C)cc1 |
| InChI | InChI=1S/C20H28O2/c1-15-7-6-13-19(2,3)18(15)12-14-20(4,21)16-8-10-17(22-5)11-9-16/h7-12,14,18,21H,6,13H2,1-5H3/b14-12+ |
| InChIKey | QBKXAOFXIKDEQA-WYMLVPIESA-N |
| XLogP | 4.84 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|