About 2-(3-chloro-4,4-dimethyl-2-oxoimidazolidin-1-yl)ethyl-trimethylazanium
2-(3-chloro-4,4-dimethyl-2-oxoimidazolidin-1-yl)ethyl-trimethylazanium (PubChem CID 46202340) has the molecular formula C10H21ClN3O+
and a molecular weight of 234.75 g/mol. Its IUPAC name is 2-(3-chloro-4,4-dimethyl-2-oxoimidazolidin-1-yl)ethyl-trimethylazanium.
Molecular Properties
| Compound Name | 2-(3-chloro-4,4-dimethyl-2-oxoimidazolidin-1-yl)ethyl-trimethylazanium |
| PubChem CID | 46202340 |
| Molecular Formula | C10H21ClN3O+ |
| Molecular Weight | 234.75 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 2-(3-chloro-4,4-dimethyl-2-oxoimidazolidin-1-yl)ethyl-trimethylazanium |
| SMILES | CC1(C)CN(CC[N+](C)(C)C)C(=O)N1Cl |
| InChI | InChI=1S/C10H21ClN3O/c1-10(2)8-12(9(15)13(10)11)6-7-14(3,4)5/h6-8H2,1-5H3/q+1 |
| InChIKey | VSOWCGBQFZVGGR-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.75 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-chloro-4,4-dimethyl-2-oxoimidazolidin-1-yl)ethyl-trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chloro-4,4-dimethyl-2-oxoimidazolidin-1-yl)ethyl-trimethylazanium?
The IUPAC name of 2-(3-chloro-4,4-dimethyl-2-oxoimidazolidin-1-yl)ethyl-trimethylazanium (CID 46202340) is 2-(3-chloro-4,4-dimethyl-2-oxoimidazolidin-1-yl)ethyl-trimethylazanium.
What is the SMILES notation for 2-(3-chloro-4,4-dimethyl-2-oxoimidazolidin-1-yl)ethyl-trimethylazanium?
The canonical SMILES for 2-(3-chloro-4,4-dimethyl-2-oxoimidazolidin-1-yl)ethyl-trimethylazanium is CC1(C)CN(CC[N+](C)(C)C)C(=O)N1Cl.
What is the InChIKey of 2-(3-chloro-4,4-dimethyl-2-oxoimidazolidin-1-yl)ethyl-trimethylazanium?
The InChIKey is VSOWCGBQFZVGGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21ClN3O/c1-10(2)8-12(9(15)13(10)11)6-7-14(3,4)5/h6-8H2,1-5H3/q+1.
What are the key properties of 2-(3-chloro-4,4-dimethyl-2-oxoimidazolidin-1-yl)ethyl-trimethylazanium?
2-(3-chloro-4,4-dimethyl-2-oxoimidazolidin-1-yl)ethyl-trimethylazanium has a molecular weight of 234.75 g/mol, XLogP of 1.36, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chloro-4,4-dimethyl-2-oxoimidazolidin-1-yl)ethyl-trimethylazanium is sourced from PubChem (CID 46202340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).