C13H27Cl2N3O — CID 46202348
3-(3-chloro-2,2,5,5-tetramethyl-4-oxoimidazolidin-1-yl)propyl-trimethylazanium chloride (PubChem CID 46202348) has the molecular formula C13H27Cl2N3O and a molecular weight of 312.29 g/mol. Its IUPAC name is 3-(3-chloro-2,2,5,5-tetramethyl-4-oxoimidazolidin-1-yl)propyl-trimethylazanium chloride.
| Compound Name | 3-(3-chloro-2,2,5,5-tetramethyl-4-oxoimidazolidin-1-yl)propyl-trimethylazanium chloride |
|---|---|
| PubChem CID | 46202348 |
| Molecular Formula | C13H27Cl2N3O |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 3-(3-chloro-2,2,5,5-tetramethyl-4-oxoimidazolidin-1-yl)propyl-trimethylazanium chloride |
| SMILES | CC1(C)C(=O)N(Cl)C(C)(C)N1CCC[N+](C)(C)C.[Cl-] |
| InChI | InChI=1S/C13H27ClN3O.ClH/c1-12(2)11(18)16(14)13(3,4)15(12)9-8-10-17(5,6)7;/h8-10H2,1-7H3;1H/q+1;/p-1 |
| InChIKey | OWRBMCMQKBUYBT-UHFFFAOYSA-M |
| XLogP | -1.10 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|