C13H27ClN3O+ — CID 46202351
3-(3-chloro-2,2,4,4-tetramethyl-5-oxoimidazolidin-1-yl)propyl-trimethylazanium (PubChem CID 46202351) has the molecular formula C13H27ClN3O+ and a molecular weight of 276.83 g/mol. Its IUPAC name is 3-(3-chloro-2,2,4,4-tetramethyl-5-oxoimidazolidin-1-yl)propyl-trimethylazanium.
| Compound Name | 3-(3-chloro-2,2,4,4-tetramethyl-5-oxoimidazolidin-1-yl)propyl-trimethylazanium |
|---|---|
| PubChem CID | 46202351 |
| Molecular Formula | C13H27ClN3O+ |
| Molecular Weight | 276.83 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 3-(3-chloro-2,2,4,4-tetramethyl-5-oxoimidazolidin-1-yl)propyl-trimethylazanium |
| SMILES | CC1(C)C(=O)N(CCC[N+](C)(C)C)C(C)(C)N1Cl |
| InChI | InChI=1S/C13H27ClN3O/c1-12(2)11(18)15(13(3,4)16(12)14)9-8-10-17(5,6)7/h8-10H2,1-7H3/q+1 |
| InChIKey | KKRPRDFVGOSKGC-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.83 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|