C18H13F3N2O — CID 46202390
2-[2-oxo-6-[4-(trifluoromethyl)phenyl]-3,4-dihydroquinolin-1-yl]acetonitrile (PubChem CID 46202390) has the molecular formula C18H13F3N2O and a molecular weight of 330.31 g/mol. Its IUPAC name is 2-[2-oxo-6-[4-(trifluoromethyl)phenyl]-3,4-dihydroquinolin-1-yl]acetonitrile.
| Compound Name | 2-[2-oxo-6-[4-(trifluoromethyl)phenyl]-3,4-dihydroquinolin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 46202390 |
| Molecular Formula | C18H13F3N2O |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 2-[2-oxo-6-[4-(trifluoromethyl)phenyl]-3,4-dihydroquinolin-1-yl]acetonitrile |
| SMILES | N#CCN1C(=O)CCc2cc(-c3ccc(C(F)(F)F)cc3)ccc21 |
| InChI | InChI=1S/C18H13F3N2O/c19-18(20,21)15-5-1-12(2-6-15)13-3-7-16-14(11-13)4-8-17(24)23(16)10-9-22/h1-3,5-7,11H,4,8,10H2 |
| InChIKey | QLHDOTDSJVTGHK-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|