benzyl 3-formylpyrrolidine-1-carboxylate

C13H15NO3 — CID 4620242

IUPACbenzyl 3-formylpyrrolidine-1-carboxylate
SMILESO=CC1CCN(C(=O)OCc2ccccc2)C1
InChIInChI=1S/C13H15NO3/c15-9-12-6-7-14(8-12)13(16)17-10-11-4-2-1-3-5-11/h1-5,9,12H,6-8,10H2
InChIKeyGDPSCBPOCONUDM-UHFFFAOYSA-N
MW233.27 g/mol
LogP1.84
Rot. Bonds3

About benzyl 3-formylpyrrolidine-1-carboxylate

benzyl 3-formylpyrrolidine-1-carboxylate (PubChem CID 4620242) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is benzyl 3-formylpyrrolidine-1-carboxylate.

Molecular Properties

Compound Namebenzyl 3-formylpyrrolidine-1-carboxylate
PubChem CID4620242
Molecular FormulaC13H15NO3
Molecular Weight233.27 g/mol
Exact Mass233.11
IUPAC Namebenzyl 3-formylpyrrolidine-1-carboxylate
SMILESO=CC1CCN(C(=O)OCc2ccccc2)C1
InChIInChI=1S/C13H15NO3/c15-9-12-6-7-14(8-12)13(16)17-10-11-4-2-1-3-5-11/h1-5,9,12H,6-8,10H2
InChIKeyGDPSCBPOCONUDM-UHFFFAOYSA-N
XLogP1.84
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.27
LogP ≤ 51.84
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze benzyl 3-formylpyrrolidine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 3-formylpyrrolidine-1-carboxylate?
The IUPAC name of benzyl 3-formylpyrrolidine-1-carboxylate (CID 4620242) is benzyl 3-formylpyrrolidine-1-carboxylate.
What is the SMILES notation for benzyl 3-formylpyrrolidine-1-carboxylate?
The canonical SMILES for benzyl 3-formylpyrrolidine-1-carboxylate is O=CC1CCN(C(=O)OCc2ccccc2)C1.
What is the InChIKey of benzyl 3-formylpyrrolidine-1-carboxylate?
The InChIKey is GDPSCBPOCONUDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO3/c15-9-12-6-7-14(8-12)13(16)17-10-11-4-2-1-3-5-11/h1-5,9,12H,6-8,10H2.
What are the key properties of benzyl 3-formylpyrrolidine-1-carboxylate?
benzyl 3-formylpyrrolidine-1-carboxylate has a molecular weight of 233.27 g/mol, XLogP of 1.84, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 3-formylpyrrolidine-1-carboxylate is sourced from PubChem (CID 4620242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).