C23H34O — CID 46202512
(E)-2-(4-tert-butylphenyl)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-ol (PubChem CID 46202512) has the molecular formula C23H34O and a molecular weight of 326.52 g/mol. Its IUPAC name is (E)-2-(4-tert-butylphenyl)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-ol.
| Compound Name | (E)-2-(4-tert-butylphenyl)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-ol |
|---|---|
| PubChem CID | 46202512 |
| Molecular Formula | C23H34O |
| Molecular Weight | 326.52 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | (E)-2-(4-tert-butylphenyl)-4-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-2-ol |
| SMILES | CC1=CCCC(C)(C)C1/C=C/C(C)(O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H34O/c1-17-9-8-15-22(5,6)20(17)14-16-23(7,24)19-12-10-18(11-13-19)21(2,3)4/h9-14,16,20,24H,8,15H2,1-7H3/b16-14+ |
| InChIKey | QJUKQGRCPPAPND-JQIJEIRASA-N |
| XLogP | 6.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.52 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|