C20H14ClN3O3 — CID 46202553
N-(4-chloro-2-pyridinyl)-5-methoxy-9-oxo-10H-acridine-4-carboxamide (PubChem CID 46202553) has the molecular formula C20H14ClN3O3 and a molecular weight of 379.80 g/mol. Its IUPAC name is N-(4-chloro-2-pyridinyl)-5-methoxy-9-oxo-10H-acridine-4-carboxamide.
| Compound Name | N-(4-chloro-2-pyridinyl)-5-methoxy-9-oxo-10H-acridine-4-carboxamide |
|---|---|
| PubChem CID | 46202553 |
| Molecular Formula | C20H14ClN3O3 |
| Molecular Weight | 379.80 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | N-(4-chloro-2-pyridinyl)-5-methoxy-9-oxo-10H-acridine-4-carboxamide |
| SMILES | COc1cccc2c(=O)c3cccc(C(=O)Nc4cc(Cl)ccn4)c3[nH]c12 |
| InChI | InChI=1S/C20H14ClN3O3/c1-27-15-7-3-5-13-18(15)24-17-12(19(13)25)4-2-6-14(17)20(26)23-16-10-11(21)8-9-22-16/h2-10H,1H3,(H,24,25)(H,22,23,26) |
| InChIKey | RTHRZGNKRQCGAC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.80 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|