About (2R)-2-hydroxybutanal
(2R)-2-hydroxybutanal (PubChem CID 46202777) has the molecular formula C4H8O2
and a molecular weight of 88.11 g/mol. Its IUPAC name is (2R)-2-hydroxybutanal.
Molecular Properties
| Compound Name | (2R)-2-hydroxybutanal |
| PubChem CID | 46202777 |
| Molecular Formula | C4H8O2 |
| Molecular Weight | 88.11 g/mol |
| Exact Mass | 88.05 |
| IUPAC Name | (2R)-2-hydroxybutanal |
| SMILES | CC[C@@H](O)C=O |
| InChI | InChI=1S/C4H8O2/c1-2-4(6)3-5/h3-4,6H,2H2,1H3/t4-/m1/s1 |
| InChIKey | UIKQNMXWCYQNCS-SCSAIBSYSA-N |
| XLogP | -0.04 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 88.11 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-hydroxybutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-hydroxybutanal?
The IUPAC name of (2R)-2-hydroxybutanal (CID 46202777) is (2R)-2-hydroxybutanal.
What is the SMILES notation for (2R)-2-hydroxybutanal?
The canonical SMILES for (2R)-2-hydroxybutanal is CC[C@@H](O)C=O.
What is the InChIKey of (2R)-2-hydroxybutanal?
The InChIKey is UIKQNMXWCYQNCS-SCSAIBSYSA-N. The full InChI is InChI=1S/C4H8O2/c1-2-4(6)3-5/h3-4,6H,2H2,1H3/t4-/m1/s1.
What are the key properties of (2R)-2-hydroxybutanal?
(2R)-2-hydroxybutanal has a molecular weight of 88.11 g/mol, XLogP of -0.04, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-hydroxybutanal is sourced from PubChem (CID 46202777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).