C25H24BrN3O2 — CID 46203031
1-(3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-4-yl)-2-[5-(4-bromophenyl)imidazo[1,2-b]isoindol-5-yl]ethanone (PubChem CID 46203031) has the molecular formula C25H24BrN3O2 and a molecular weight of 478.39 g/mol. Its IUPAC name is 1-(3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-4-yl)-2-[5-(4-bromophenyl)imidazo[1,2-b]isoindol-5-yl]ethanone.
| Compound Name | 1-(3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-4-yl)-2-[5-(4-bromophenyl)imidazo[1,2-b]isoindol-5-yl]ethanone |
|---|---|
| PubChem CID | 46203031 |
| Molecular Formula | C25H24BrN3O2 |
| Molecular Weight | 478.39 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | 1-(3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-4-yl)-2-[5-(4-bromophenyl)imidazo[1,2-b]isoindol-5-yl]ethanone |
| SMILES | O=C(CC1(c2ccc(Br)cc2)c2ccccc2-c2nccn21)N1CCCC2OCCC21 |
| InChI | InChI=1S/C25H24BrN3O2/c26-18-9-7-17(8-10-18)25(16-23(30)28-13-3-6-22-21(28)11-15-31-22)20-5-2-1-4-19(20)24-27-12-14-29(24)25/h1-2,4-5,7-10,12,14,21-22H,3,6,11,13,15-16H2 |
| InChIKey | HVJGRPUHRMMFOU-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.39 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |