C14H8Cl2N4O2S — CID 46203162
3-[(2,4-dichlorophenoxy)methyl]-6-(furan-2-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 46203162) has the molecular formula C14H8Cl2N4O2S and a molecular weight of 367.22 g/mol. Its IUPAC name is 3-[(2,4-dichlorophenoxy)methyl]-6-(furan-2-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 3-[(2,4-dichlorophenoxy)methyl]-6-(furan-2-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 46203162 |
| Molecular Formula | C14H8Cl2N4O2S |
| Molecular Weight | 367.22 g/mol |
| Exact Mass | 365.97 |
| IUPAC Name | 3-[(2,4-dichlorophenoxy)methyl]-6-(furan-2-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | Clc1ccc(OCc2nnc3sc(-c4ccco4)nn23)c(Cl)c1 |
| InChI | InChI=1S/C14H8Cl2N4O2S/c15-8-3-4-10(9(16)6-8)22-7-12-17-18-14-20(12)19-13(23-14)11-2-1-5-21-11/h1-6H,7H2 |
| InChIKey | GFVZZZZROLKDRK-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 65.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.22 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |