C25H23F3N4O2 — CID 46203293
(9E)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3-(3,4,5-trifluorophenyl)-4,6,7,8-tetrahydro-3H-pyrido[2,1-c][1,2,4]oxadiazine (PubChem CID 46203293) has the molecular formula C25H23F3N4O2 and a molecular weight of 468.48 g/mol. Its IUPAC name is (9E)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3-(3,4,5-trifluorophenyl)-4,6,7,8-tetrahydro-3H-pyrido[2,1-c][1,2,4]oxadiazine.
| Compound Name | (9E)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3-(3,4,5-trifluorophenyl)-4,6,7,8-tetrahydro-3H-pyrido[2,1-c][1,2,4]oxadiazine |
|---|---|
| PubChem CID | 46203293 |
| Molecular Formula | C25H23F3N4O2 |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | (9E)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3-(3,4,5-trifluorophenyl)-4,6,7,8-tetrahydro-3H-pyrido[2,1-c][1,2,4]oxadiazine |
| SMILES | COc1cc(/C=C2\CCCN3CC(c4cc(F)c(F)c(F)c4)ON=C23)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C25H23F3N4O2/c1-15-12-32(14-29-15)21-6-5-16(9-22(21)33-2)8-17-4-3-7-31-13-23(34-30-25(17)31)18-10-19(26)24(28)20(27)11-18/h5-6,8-12,14,23H,3-4,7,13H2,1-2H3/b17-8+ |
| InChIKey | HBUBADLJXCGBKE-CAOOACKPSA-N |
| XLogP | 5.17 |
| TPSA | 51.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|