C22H26N4O2 — CID 46203316
N-(2-aminophenyl)-7-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]heptanamide (PubChem CID 46203316) has the molecular formula C22H26N4O2 and a molecular weight of 378.48 g/mol. Its IUPAC name is N-(2-aminophenyl)-7-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]heptanamide.
| Compound Name | N-(2-aminophenyl)-7-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]heptanamide |
|---|---|
| PubChem CID | 46203316 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | N-(2-aminophenyl)-7-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]heptanamide |
| SMILES | Cc1ccc(-c2noc(CCCCCCC(=O)Nc3ccccc3N)n2)cc1 |
| InChI | InChI=1S/C22H26N4O2/c1-16-12-14-17(15-13-16)22-25-21(28-26-22)11-5-3-2-4-10-20(27)24-19-9-7-6-8-18(19)23/h6-9,12-15H,2-5,10-11,23H2,1H3,(H,24,27) |
| InChIKey | QOKAHFFPOVFSKD-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|