C24H29ClN2O — CID 46203341
(3aS,3bS,9aR,9bS,11aS)-1-(4-chloro-3-pyridinyl)-5,9a,11a-trimethyl-3a,3b,4,8,9,9b,10,11-octahydro-3H-cyclopenta[i]phenanthridin-7-one (PubChem CID 46203341) has the molecular formula C24H29ClN2O and a molecular weight of 396.96 g/mol. Its IUPAC name is (3aS,3bS,9aR,9bS,11aS)-1-(4-chloro-3-pyridinyl)-5,9a,11a-trimethyl-3a,3b,4,8,9,9b,10,11-octahydro-3H-cyclopenta[i]phenanthridin-7-one.
| Compound Name | (3aS,3bS,9aR,9bS,11aS)-1-(4-chloro-3-pyridinyl)-5,9a,11a-trimethyl-3a,3b,4,8,9,9b,10,11-octahydro-3H-cyclopenta[i]phenanthridin-7-one |
|---|---|
| PubChem CID | 46203341 |
| Molecular Formula | C24H29ClN2O |
| Molecular Weight | 396.96 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | (3aS,3bS,9aR,9bS,11aS)-1-(4-chloro-3-pyridinyl)-5,9a,11a-trimethyl-3a,3b,4,8,9,9b,10,11-octahydro-3H-cyclopenta[i]phenanthridin-7-one |
| SMILES | CN1C[C@@H]2[C@H](CC[C@]3(C)C(c4cnccc4Cl)=CC[C@@H]23)[C@@]2(C)CCC(=O)C=C12 |
| InChI | InChI=1S/C24H29ClN2O/c1-23-10-7-20-17(14-27(3)22-12-15(28)6-9-24(20,22)2)19(23)5-4-18(23)16-13-26-11-8-21(16)25/h4,8,11-13,17,19-20H,5-7,9-10,14H2,1-3H3/t17-,19-,20-,23+,24+/m0/s1 |
| InChIKey | JBNWQYUIFZJWNH-WEBNEGJXSA-N |
| XLogP | 5.37 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.96 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |