About 5-hydroxy-2-[(E)-2-(4-hydroxyphenyl)ethenyl]-N,N-dimethylbenzamide
5-hydroxy-2-[(E)-2-(4-hydroxyphenyl)ethenyl]-N,N-dimethylbenzamide (PubChem CID 46203476) has the molecular formula C17H17NO3
and a molecular weight of 283.33 g/mol. Its IUPAC name is 5-hydroxy-2-[(E)-2-(4-hydroxyphenyl)ethenyl]-N,N-dimethylbenzamide.
Molecular Properties
| Compound Name | 5-hydroxy-2-[(E)-2-(4-hydroxyphenyl)ethenyl]-N,N-dimethylbenzamide |
| PubChem CID | 46203476 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 5-hydroxy-2-[(E)-2-(4-hydroxyphenyl)ethenyl]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cc(O)ccc1/C=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C17H17NO3/c1-18(2)17(21)16-11-15(20)10-7-13(16)6-3-12-4-8-14(19)9-5-12/h3-11,19-20H,1-2H3/b6-3+ |
| InChIKey | NNIIEHRWMGMHHV-ZZXKWVIFSA-N |
| XLogP | 2.97 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxy-2-[(E)-2-(4-hydroxyphenyl)ethenyl]-N,N-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-2-[(E)-2-(4-hydroxyphenyl)ethenyl]-N,N-dimethylbenzamide?
The IUPAC name of 5-hydroxy-2-[(E)-2-(4-hydroxyphenyl)ethenyl]-N,N-dimethylbenzamide (CID 46203476) is 5-hydroxy-2-[(E)-2-(4-hydroxyphenyl)ethenyl]-N,N-dimethylbenzamide.
What is the SMILES notation for 5-hydroxy-2-[(E)-2-(4-hydroxyphenyl)ethenyl]-N,N-dimethylbenzamide?
The canonical SMILES for 5-hydroxy-2-[(E)-2-(4-hydroxyphenyl)ethenyl]-N,N-dimethylbenzamide is CN(C)C(=O)c1cc(O)ccc1/C=C/c1ccc(O)cc1.
What is the InChIKey of 5-hydroxy-2-[(E)-2-(4-hydroxyphenyl)ethenyl]-N,N-dimethylbenzamide?
The InChIKey is NNIIEHRWMGMHHV-ZZXKWVIFSA-N. The full InChI is InChI=1S/C17H17NO3/c1-18(2)17(21)16-11-15(20)10-7-13(16)6-3-12-4-8-14(19)9-5-12/h3-11,19-20H,1-2H3/b6-3+.
What are the key properties of 5-hydroxy-2-[(E)-2-(4-hydroxyphenyl)ethenyl]-N,N-dimethylbenzamide?
5-hydroxy-2-[(E)-2-(4-hydroxyphenyl)ethenyl]-N,N-dimethylbenzamide has a molecular weight of 283.33 g/mol, XLogP of 2.97, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-2-[(E)-2-(4-hydroxyphenyl)ethenyl]-N,N-dimethylbenzamide is sourced from PubChem (CID 46203476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).